C28H32F2N4O2 — CID 143996286
(3R,10E)-3-(3,5-difluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine;ethane (PubChem CID 143996286) has the molecular formula C28H32F2N4O2 and a molecular weight of 494.59 g/mol. Its IUPAC name is (3R,10E)-3-(3,5-difluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine;ethane.
| Compound Name | (3R,10E)-3-(3,5-difluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine;ethane |
|---|---|
| PubChem CID | 143996286 |
| Molecular Formula | C28H32F2N4O2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | (3R,10E)-3-(3,5-difluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine;ethane |
| SMILES | CC.COc1cc(/C=C2\CCCN3CC[C@H](c4cc(F)cc(F)c4)ON=C23)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H26F2N4O2.C2H6/c1-17-15-32(16-29-17)23-6-5-18(11-25(23)33-2)10-19-4-3-8-31-9-7-24(34-30-26(19)31)20-12-21(27)14-22(28)13-20;1-2/h5-6,10-16,24H,3-4,7-9H2,1-2H3;1-2H3/b19-10+;/t24-;/m1./s1 |
| InChIKey | UVXDWDVJKBMLHM-NEPWPOEQSA-N |
| XLogP | 6.45 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |