C21H26N4O2 — CID 58528731
(9E)-3-ethyl-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine (PubChem CID 58528731) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (9E)-3-ethyl-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine.
| Compound Name | (9E)-3-ethyl-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 58528731 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (9E)-3-ethyl-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
| SMILES | CCC1CN2CCC/C(=C\c3ccc(-n4cnc(C)c4)c(OC)c3)C2=NO1 |
| InChI | InChI=1S/C21H26N4O2/c1-4-18-13-24-9-5-6-17(21(24)23-27-18)10-16-7-8-19(20(11-16)26-3)25-12-15(2)22-14-25/h7-8,10-12,14,18H,4-6,9,13H2,1-3H3/b17-10+ |
| InChIKey | WNMKVHOFPLBJHE-LICLKQGHSA-N |
| XLogP | 3.79 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |