C26H28N4O3 — CID 76813952
9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(phenoxymethyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine (PubChem CID 76813952) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(phenoxymethyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine.
| Compound Name | 9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(phenoxymethyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 76813952 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(phenoxymethyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
| SMILES | COc1cc(C=C2CCCN3CC(COc4ccccc4)ON=C23)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H28N4O3/c1-19-15-30(18-27-19)24-11-10-20(14-25(24)31-2)13-21-7-6-12-29-16-23(33-28-26(21)29)17-32-22-8-4-3-5-9-22/h3-5,8-11,13-15,18,23H,6-7,12,16-17H2,1-2H3 |
| InChIKey | GFRAZNIPEBVVEG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 61.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |