C26H28N4O2 — CID 123674061
(3R)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-phenyl-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine (PubChem CID 123674061) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is (3R)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-phenyl-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine.
| Compound Name | (3R)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-phenyl-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine |
|---|---|
| PubChem CID | 123674061 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (3R)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-phenyl-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine |
| SMILES | COc1cc(C=C2CCCN3CC[C@H](c4ccccc4)ON=C23)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H28N4O2/c1-19-17-30(18-27-19)23-11-10-20(16-25(23)31-2)15-22-9-6-13-29-14-12-24(32-28-26(22)29)21-7-4-3-5-8-21/h3-5,7-8,10-11,15-18,24H,6,9,12-14H2,1-2H3/t24-/m1/s1 |
| InChIKey | DQOYEQSNDJFFKT-XMMPIXPASA-N |
| XLogP | 5.14 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |