C26H26F2N4O2 — CID 46214506
(5R,10E)-5-(3,5-difluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine (PubChem CID 46214506) has the molecular formula C26H26F2N4O2 and a molecular weight of 464.52 g/mol. Its IUPAC name is (5R,10E)-5-(3,5-difluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine.
| Compound Name | (5R,10E)-5-(3,5-difluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine |
|---|---|
| PubChem CID | 46214506 |
| Molecular Formula | C26H26F2N4O2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (5R,10E)-5-(3,5-difluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine |
| SMILES | COc1cc(/C=C2\CCCN3C2=NOCC[C@@H]3c2cc(F)cc(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H26F2N4O2/c1-17-15-31(16-29-17)24-6-5-18(11-25(24)33-2)10-19-4-3-8-32-23(7-9-34-30-26(19)32)20-12-21(27)14-22(28)13-20/h5-6,10-16,23H,3-4,7-9H2,1-2H3/b19-10+/t23-/m1/s1 |
| InChIKey | PZZGJFDIBVUQCH-ALMVOQMYSA-N |
| XLogP | 5.42 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |