C25H27FN4O2 — CID 70225320
(4S,9E)-4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,6,7,8,9a-hexahydro-1H-pyrido[2,1-c][1,2,4]oxadiazine (PubChem CID 70225320) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is (4S,9E)-4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,6,7,8,9a-hexahydro-1H-pyrido[2,1-c][1,2,4]oxadiazine.
| Compound Name | (4S,9E)-4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,6,7,8,9a-hexahydro-1H-pyrido[2,1-c][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 70225320 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (4S,9E)-4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,4,6,7,8,9a-hexahydro-1H-pyrido[2,1-c][1,2,4]oxadiazine |
| SMILES | COc1cc(/C=C2\CCCN3C2NOC[C@@H]3c2ccc(F)cc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H27FN4O2/c1-17-14-29(16-27-17)22-10-5-18(13-24(22)31-2)12-20-4-3-11-30-23(15-32-28-25(20)30)19-6-8-21(26)9-7-19/h5-10,12-14,16,23,25,28H,3-4,11,15H2,1-2H3/b20-12+/t23-,25?/m1/s1 |
| InChIKey | MRDDNUTURDVPEK-IQYUYDTKSA-N |
| XLogP | 4.41 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |