C26H30FN5O — CID 25185044
(2Z,5S)-8-ethyl-5-(4-fluorophenyl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,3,5,6,7,8a-hexahydroimidazo[1,2-a]pyrimidine (PubChem CID 25185044) has the molecular formula C26H30FN5O and a molecular weight of 447.56 g/mol. Its IUPAC name is (2Z,5S)-8-ethyl-5-(4-fluorophenyl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,3,5,6,7,8a-hexahydroimidazo[1,2-a]pyrimidine.
| Compound Name | (2Z,5S)-8-ethyl-5-(4-fluorophenyl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,3,5,6,7,8a-hexahydroimidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 25185044 |
| Molecular Formula | C26H30FN5O |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (2Z,5S)-8-ethyl-5-(4-fluorophenyl)-2-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,3,5,6,7,8a-hexahydroimidazo[1,2-a]pyrimidine |
| SMILES | CCN1CC[C@@H](c2ccc(F)cc2)N2C/C(=C/c3ccc(-n4cnc(C)c4)c(OC)c3)NC12 |
| InChI | InChI=1S/C26H30FN5O/c1-4-30-12-11-23(20-6-8-21(27)9-7-20)32-16-22(29-26(30)32)13-19-5-10-24(25(14-19)33-3)31-15-18(2)28-17-31/h5-10,13-15,17,23,26,29H,4,11-12,16H2,1-3H3/b22-13-/t23-,26?/m0/s1 |
| InChIKey | GZECHTSWTUPXBO-JWAAFFHSSA-N |
| XLogP | 4.33 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |