C26H26FN5O2 — CID 77334681
5-(4-fluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,7,8,9-tetrahydro-3H-pyrido[1,2-b][1,2,4]triazepin-2-one (PubChem CID 77334681) has the molecular formula C26H26FN5O2 and a molecular weight of 459.53 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,7,8,9-tetrahydro-3H-pyrido[1,2-b][1,2,4]triazepin-2-one.
| Compound Name | 5-(4-fluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,7,8,9-tetrahydro-3H-pyrido[1,2-b][1,2,4]triazepin-2-one |
|---|---|
| PubChem CID | 77334681 |
| Molecular Formula | C26H26FN5O2 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 5-(4-fluorophenyl)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,7,8,9-tetrahydro-3H-pyrido[1,2-b][1,2,4]triazepin-2-one |
| SMILES | COc1cc(C=C2CCCN3C2=NC(=O)CCN3c2ccc(F)cc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H26FN5O2/c1-18-16-30(17-28-18)23-10-5-19(15-24(23)34-2)14-20-4-3-12-32-26(20)29-25(33)11-13-31(32)22-8-6-21(27)7-9-22/h5-10,14-17H,3-4,11-13H2,1-2H3 |
| InChIKey | PJARZRZBZXCOKB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |