C23H25FN4O2 — CID 74401540
N'-[1-(4-fluorophenyl)ethyl]-N-methoxy-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enimidamide (PubChem CID 74401540) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)ethyl]-N-methoxy-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enimidamide.
| Compound Name | N'-[1-(4-fluorophenyl)ethyl]-N-methoxy-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enimidamide |
|---|---|
| PubChem CID | 74401540 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N'-[1-(4-fluorophenyl)ethyl]-N-methoxy-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enimidamide |
| SMILES | CON/C(C=Cc1ccc(-n2cnc(C)c2)c(OC)c1)=N\C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H25FN4O2/c1-16-14-28(15-25-16)21-11-5-18(13-22(21)29-3)6-12-23(27-30-4)26-17(2)19-7-9-20(24)10-8-19/h5-15,17H,1-4H3,(H,26,27) |
| InChIKey | YBHXGEDUTMIKAN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 60.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|