C24H21FN2O6 — CID 86615141
methyl 3-(4-fluorophenyl)-2-[(E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enoyl]oxy-3-oxopropanoate (PubChem CID 86615141) has the molecular formula C24H21FN2O6 and a molecular weight of 452.44 g/mol. Its IUPAC name is methyl 3-(4-fluorophenyl)-2-[(E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enoyl]oxy-3-oxopropanoate.
| Compound Name | methyl 3-(4-fluorophenyl)-2-[(E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enoyl]oxy-3-oxopropanoate |
|---|---|
| PubChem CID | 86615141 |
| Molecular Formula | C24H21FN2O6 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | methyl 3-(4-fluorophenyl)-2-[(E)-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enoyl]oxy-3-oxopropanoate |
| SMILES | COC(=O)C(OC(=O)/C=C/c1ccc(-n2cnc(C)c2)c(OC)c1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H21FN2O6/c1-15-13-27(14-26-15)19-10-4-16(12-20(19)31-2)5-11-21(28)33-23(24(30)32-3)22(29)17-6-8-18(25)9-7-17/h4-14,23H,1-3H3/b11-5+ |
| InChIKey | BPOXBAPVARJPDF-VZUCSPMQSA-N |
| XLogP | 3.31 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|