C19H19Cl3N4O2 — CID 11683670
N-(3,5-dichloro-4-pyridinyl)-6-methoxy-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-9-carboxamide;hydrochloride (PubChem CID 11683670) has the molecular formula C19H19Cl3N4O2 and a molecular weight of 441.75 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-6-methoxy-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-9-carboxamide;hydrochloride.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-6-methoxy-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-9-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 11683670 |
| Molecular Formula | C19H19Cl3N4O2 |
| Molecular Weight | 441.75 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-6-methoxy-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-9-carboxamide;hydrochloride |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)c2c3c(n(C)c12)CCNC3.Cl |
| InChI | InChI=1S/C19H18Cl2N4O2.ClH/c1-25-14-5-6-22-7-11(14)16-10(3-4-15(27-2)18(16)25)19(26)24-17-12(20)8-23-9-13(17)21;/h3-4,8-9,22H,5-7H2,1-2H3,(H,23,24,26);1H |
| InChIKey | ZRQOXYUJHUPNRT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |