C15H10Cl2N2O3 — CID 22734346
N-(3,5-dichloro-4-pyridinyl)-7-methoxy-1-benzofuran-4-carboxamide (PubChem CID 22734346) has the molecular formula C15H10Cl2N2O3 and a molecular weight of 337.16 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-7-methoxy-1-benzofuran-4-carboxamide.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-7-methoxy-1-benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 22734346 |
| Molecular Formula | C15H10Cl2N2O3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-7-methoxy-1-benzofuran-4-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)c2ccoc12 |
| InChI | InChI=1S/C15H10Cl2N2O3/c1-21-12-3-2-9(8-4-5-22-14(8)12)15(20)19-13-10(16)6-18-7-11(13)17/h2-7H,1H3,(H,18,19,20) |
| InChIKey | IJOCDYMFIRKGJK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |