C19H13Cl2N3O3 — CID 141311762
7-amino-N-(3,5-dichloro-4-pyridinyl)-1-methoxydibenzofuran-4-carboxamide (PubChem CID 141311762) has the molecular formula C19H13Cl2N3O3 and a molecular weight of 402.24 g/mol. Its IUPAC name is 7-amino-N-(3,5-dichloro-4-pyridinyl)-1-methoxydibenzofuran-4-carboxamide.
| Compound Name | 7-amino-N-(3,5-dichloro-4-pyridinyl)-1-methoxydibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 141311762 |
| Molecular Formula | C19H13Cl2N3O3 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 7-amino-N-(3,5-dichloro-4-pyridinyl)-1-methoxydibenzofuran-4-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)c2oc3cc(N)ccc3c12 |
| InChI | InChI=1S/C19H13Cl2N3O3/c1-26-14-5-4-11(19(25)24-17-12(20)7-23-8-13(17)21)18-16(14)10-3-2-9(22)6-15(10)27-18/h2-8H,22H2,1H3,(H,23,24,25) |
| InChIKey | VKBXSEQZTRAHIA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|