C21H12Cl2N3NaO6 — CID 23686730
sodium 2-[[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]amino]-2-oxoacetate (PubChem CID 23686730) has the molecular formula C21H12Cl2N3NaO6 and a molecular weight of 496.24 g/mol. Its IUPAC name is sodium 2-[[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]amino]-2-oxoacetate.
| Compound Name | sodium 2-[[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 23686730 |
| Molecular Formula | C21H12Cl2N3NaO6 |
| Molecular Weight | 496.24 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | sodium 2-[[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]amino]-2-oxoacetate |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)c2c1oc1ccc(NC(=O)C(=O)[O-])cc12.[Na+] |
| InChI | InChI=1S/C21H13Cl2N3O6.Na/c1-31-15-5-3-10(19(27)26-17-12(22)7-24-8-13(17)23)16-11-6-9(25-20(28)21(29)30)2-4-14(11)32-18(15)16;/h2-8H,1H3,(H,25,28)(H,29,30)(H,24,26,27);/q;+1/p-1 |
| InChIKey | YCDGJDZPJPWGEJ-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|