C12H13N — CID 116836914
2-(2,4-dimethylphenyl)cyclopropane-1-carbonitrile (PubChem CID 116836914) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)cyclopropane-1-carbonitrile.
| Compound Name | 2-(2,4-dimethylphenyl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 116836914 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 2-(2,4-dimethylphenyl)cyclopropane-1-carbonitrile |
| SMILES | Cc1ccc(C2CC2C#N)c(C)c1 |
| InChI | InChI=1S/C12H13N/c1-8-3-4-11(9(2)5-8)12-6-10(12)7-13/h3-5,10,12H,6H2,1-2H3 |
| InChIKey | PTPWHJYYIPRLPX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |