C11H13Br — CID 130539902
1-(2-bromocyclopropyl)-2,4-dimethylbenzene (PubChem CID 130539902) has the molecular formula C11H13Br and a molecular weight of 225.13 g/mol. Its IUPAC name is 1-(2-bromocyclopropyl)-2,4-dimethylbenzene.
| Compound Name | 1-(2-bromocyclopropyl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 130539902 |
| Molecular Formula | C11H13Br |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 1-(2-bromocyclopropyl)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(C2CC2Br)c(C)c1 |
| InChI | InChI=1S/C11H13Br/c1-7-3-4-9(8(2)5-7)10-6-11(10)12/h3-5,10-11H,6H2,1-2H3 |
| InChIKey | CLIYGZLQADMRPU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|