C14H19F2N — CID 116838867
3-[(2,4-dimethylphenyl)-difluoromethyl]piperidine (PubChem CID 116838867) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)-difluoromethyl]piperidine.
| Compound Name | 3-[(2,4-dimethylphenyl)-difluoromethyl]piperidine |
|---|---|
| PubChem CID | 116838867 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)-difluoromethyl]piperidine |
| SMILES | Cc1ccc(C(F)(F)C2CCCNC2)c(C)c1 |
| InChI | InChI=1S/C14H19F2N/c1-10-5-6-13(11(2)8-10)14(15,16)12-4-3-7-17-9-12/h5-6,8,12,17H,3-4,7,9H2,1-2H3 |
| InChIKey | IMVCLLKAGQCJMM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |