C14H22FN — CID 146172473
1-fluoro-2,4-dimethylbenzene;3-methylpiperidine (PubChem CID 146172473) has the molecular formula C14H22FN and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-fluoro-2,4-dimethylbenzene;3-methylpiperidine.
| Compound Name | 1-fluoro-2,4-dimethylbenzene;3-methylpiperidine |
|---|---|
| PubChem CID | 146172473 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1-fluoro-2,4-dimethylbenzene;3-methylpiperidine |
| SMILES | CC1CCCNC1.Cc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C8H9F.C6H13N/c1-6-3-4-8(9)7(2)5-6;1-6-3-2-4-7-5-6/h3-5H,1-2H3;6-7H,2-5H2,1H3 |
| InChIKey | UQIIIRISBMPKKK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |