C13H16BrF2NO — CID 116839169
2-[(3-bromo-4-methoxyphenyl)-difluoromethyl]piperidine (PubChem CID 116839169) has the molecular formula C13H16BrF2NO and a molecular weight of 320.18 g/mol. Its IUPAC name is 2-[(3-bromo-4-methoxyphenyl)-difluoromethyl]piperidine.
| Compound Name | 2-[(3-bromo-4-methoxyphenyl)-difluoromethyl]piperidine |
|---|---|
| PubChem CID | 116839169 |
| Molecular Formula | C13H16BrF2NO |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[(3-bromo-4-methoxyphenyl)-difluoromethyl]piperidine |
| SMILES | COc1ccc(C(F)(F)C2CCCCN2)cc1Br |
| InChI | InChI=1S/C13H16BrF2NO/c1-18-11-6-5-9(8-10(11)14)13(15,16)12-4-2-3-7-17-12/h5-6,8,12,17H,2-4,7H2,1H3 |
| InChIKey | IVTHICXONALMTI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |