C11H13F2N3 — CID 116839318
1,1-difluoro-1-(1-methylbenzimidazol-5-yl)propan-2-amine (PubChem CID 116839318) has the molecular formula C11H13F2N3 and a molecular weight of 225.24 g/mol. Its IUPAC name is 1,1-difluoro-1-(1-methylbenzimidazol-5-yl)propan-2-amine.
| Compound Name | 1,1-difluoro-1-(1-methylbenzimidazol-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 116839318 |
| Molecular Formula | C11H13F2N3 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1,1-difluoro-1-(1-methylbenzimidazol-5-yl)propan-2-amine |
| SMILES | CC(N)C(F)(F)c1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C11H13F2N3/c1-7(14)11(12,13)8-3-4-10-9(5-8)15-6-16(10)2/h3-7H,14H2,1-2H3 |
| InChIKey | ZWUXAFYWBBGYCW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |