C28H21F2NO3 — CID 11683958
3-[(4-fluorophenyl)methyl]-4-[[3-[(4-fluorophenyl)methyl]benzoyl]amino]benzoic acid (PubChem CID 11683958) has the molecular formula C28H21F2NO3 and a molecular weight of 457.48 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-4-[[3-[(4-fluorophenyl)methyl]benzoyl]amino]benzoic acid.
| Compound Name | 3-[(4-fluorophenyl)methyl]-4-[[3-[(4-fluorophenyl)methyl]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11683958 |
| Molecular Formula | C28H21F2NO3 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-4-[[3-[(4-fluorophenyl)methyl]benzoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cccc(Cc3ccc(F)cc3)c2)c(Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C28H21F2NO3/c29-24-9-4-18(5-10-24)14-20-2-1-3-21(16-20)27(32)31-26-13-8-22(28(33)34)17-23(26)15-19-6-11-25(30)12-7-19/h1-13,16-17H,14-15H2,(H,31,32)(H,33,34) |
| InChIKey | BZYQSZUBXSXOIL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |