C7H9BrN2OS — CID 116843844
2-(5-bromothiophen-2-yl)propanehydrazide (PubChem CID 116843844) has the molecular formula C7H9BrN2OS and a molecular weight of 249.13 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)propanehydrazide.
| Compound Name | 2-(5-bromothiophen-2-yl)propanehydrazide |
|---|---|
| PubChem CID | 116843844 |
| Molecular Formula | C7H9BrN2OS |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)propanehydrazide |
| SMILES | CC(C(=O)NN)c1ccc(Br)s1 |
| InChI | InChI=1S/C7H9BrN2OS/c1-4(7(11)10-9)5-2-3-6(8)12-5/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | CMYVQPZTSMPZSG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|