C12H13BrN2OS2 — CID 96560802
(2S)-2-(5-bromothiophen-2-yl)-N-[(3R)-3-cyanothiolan-3-yl]propanamide (PubChem CID 96560802) has the molecular formula C12H13BrN2OS2 and a molecular weight of 345.29 g/mol. Its IUPAC name is (2S)-2-(5-bromothiophen-2-yl)-N-[(3R)-3-cyanothiolan-3-yl]propanamide.
| Compound Name | (2S)-2-(5-bromothiophen-2-yl)-N-[(3R)-3-cyanothiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 96560802 |
| Molecular Formula | C12H13BrN2OS2 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | (2S)-2-(5-bromothiophen-2-yl)-N-[(3R)-3-cyanothiolan-3-yl]propanamide |
| SMILES | C[C@@H](C(=O)N[C@@]1(C#N)CCSC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H13BrN2OS2/c1-8(9-2-3-10(13)18-9)11(16)15-12(6-14)4-5-17-7-12/h2-3,8H,4-5,7H2,1H3,(H,15,16)/t8-,12-/m1/s1 |
| InChIKey | SVXANCYFJHFYMD-PRHODGIISA-N |
| XLogP | 3.13 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |