C13H18N2O2 — CID 116844174
1-(4-methoxy-2,3-dimethylphenyl)cyclopropane-1-carbohydrazide (PubChem CID 116844174) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(4-methoxy-2,3-dimethylphenyl)cyclopropane-1-carbohydrazide.
| Compound Name | 1-(4-methoxy-2,3-dimethylphenyl)cyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 116844174 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(4-methoxy-2,3-dimethylphenyl)cyclopropane-1-carbohydrazide |
| SMILES | COc1ccc(C2(C(=O)NN)CC2)c(C)c1C |
| InChI | InChI=1S/C13H18N2O2/c1-8-9(2)11(17-3)5-4-10(8)13(6-7-13)12(16)15-14/h4-5H,6-7,14H2,1-3H3,(H,15,16) |
| InChIKey | LGHVYOIMELQQNJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|