1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid

C14H18O5 — CID 117419569

IUPAC1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid
SMILESCCOc1c(C2(C(=O)O)CC2)ccc(OC)c1OC
InChIInChI=1S/C14H18O5/c1-4-19-11-9(14(7-8-14)13(15)16)5-6-10(17-2)12(11)18-3/h5-6H,4,7-8H2,1-3H3,(H,15,16)
InChIKeyZONALMAWUISCEP-UHFFFAOYSA-N
MW266.29 g/mol
LogP2.22
Rot. Bonds6

About 1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid

1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid (PubChem CID 117419569) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid
PubChem CID117419569
Molecular FormulaC14H18O5
Molecular Weight266.29 g/mol
Exact Mass266.12
IUPAC Name1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid
SMILESCCOc1c(C2(C(=O)O)CC2)ccc(OC)c1OC
InChIInChI=1S/C14H18O5/c1-4-19-11-9(14(7-8-14)13(15)16)5-6-10(17-2)12(11)18-3/h5-6H,4,7-8H2,1-3H3,(H,15,16)
InChIKeyZONALMAWUISCEP-UHFFFAOYSA-N
XLogP2.22
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.29
LogP ≤ 52.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid?
The IUPAC name of 1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid (CID 117419569) is 1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid is CCOc1c(C2(C(=O)O)CC2)ccc(OC)c1OC.
What is the InChIKey of 1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid?
The InChIKey is ZONALMAWUISCEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5/c1-4-19-11-9(14(7-8-14)13(15)16)5-6-10(17-2)12(11)18-3/h5-6H,4,7-8H2,1-3H3,(H,15,16).
What are the key properties of 1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid?
1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid has a molecular weight of 266.29 g/mol, XLogP of 2.22, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethoxy-3,4-dimethoxyphenyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 117419569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).