C11H14BrFN2O — CID 116845964
2-(5-bromo-2-fluorophenyl)-N,2-dimethylpropanehydrazide (PubChem CID 116845964) has the molecular formula C11H14BrFN2O and a molecular weight of 289.15 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-N,2-dimethylpropanehydrazide.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-N,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 116845964 |
| Molecular Formula | C11H14BrFN2O |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-N,2-dimethylpropanehydrazide |
| SMILES | CN(N)C(=O)C(C)(C)c1cc(Br)ccc1F |
| InChI | InChI=1S/C11H14BrFN2O/c1-11(2,10(16)15(3)14)8-6-7(12)4-5-9(8)13/h4-6H,14H2,1-3H3 |
| InChIKey | ULKZJVDAMVMOHR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|