About 2-(4-chlorophenyl)-N'-methylpropanehydrazide
2-(4-chlorophenyl)-N'-methylpropanehydrazide (PubChem CID 116846979) has the molecular formula C10H13ClN2O
and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N'-methylpropanehydrazide.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-N'-methylpropanehydrazide |
| PubChem CID | 116846979 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N'-methylpropanehydrazide |
| SMILES | CNNC(=O)C(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H13ClN2O/c1-7(10(14)13-12-2)8-3-5-9(11)6-4-8/h3-7,12H,1-2H3,(H,13,14) |
| InChIKey | ITZXLWYKUFJTRY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-N'-methylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-N'-methylpropanehydrazide?
The IUPAC name of 2-(4-chlorophenyl)-N'-methylpropanehydrazide (CID 116846979) is 2-(4-chlorophenyl)-N'-methylpropanehydrazide.
What is the SMILES notation for 2-(4-chlorophenyl)-N'-methylpropanehydrazide?
The canonical SMILES for 2-(4-chlorophenyl)-N'-methylpropanehydrazide is CNNC(=O)C(C)c1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-N'-methylpropanehydrazide?
The InChIKey is ITZXLWYKUFJTRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O/c1-7(10(14)13-12-2)8-3-5-9(11)6-4-8/h3-7,12H,1-2H3,(H,13,14).
What are the key properties of 2-(4-chlorophenyl)-N'-methylpropanehydrazide?
2-(4-chlorophenyl)-N'-methylpropanehydrazide has a molecular weight of 212.68 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-N'-methylpropanehydrazide is sourced from PubChem (CID 116846979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).