About 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide
2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide (PubChem CID 116846983) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide.
Molecular Properties
| Compound Name | 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide |
| PubChem CID | 116846983 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide |
| SMILES | CNNC(=O)C(C)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C12H18N2O2/c1-8-7-10(5-6-11(8)16-4)9(2)12(15)14-13-3/h5-7,9,13H,1-4H3,(H,14,15) |
| InChIKey | YAENECBHDVTLNJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide?
The IUPAC name of 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide (CID 116846983) is 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide.
What is the SMILES notation for 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide?
The canonical SMILES for 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide is CNNC(=O)C(C)c1ccc(OC)c(C)c1.
What is the InChIKey of 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide?
The InChIKey is YAENECBHDVTLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-8-7-10(5-6-11(8)16-4)9(2)12(15)14-13-3/h5-7,9,13H,1-4H3,(H,14,15).
What are the key properties of 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide?
2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide has a molecular weight of 222.29 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxy-3-methylphenyl)-N'-methylpropanehydrazide is sourced from PubChem (CID 116846983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).