C11H14F2N2O — CID 116847169
2-(2,5-difluorophenyl)-N',2-dimethylpropanehydrazide (PubChem CID 116847169) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-N',2-dimethylpropanehydrazide.
| Compound Name | 2-(2,5-difluorophenyl)-N',2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 116847169 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-(2,5-difluorophenyl)-N',2-dimethylpropanehydrazide |
| SMILES | CNNC(=O)C(C)(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H14F2N2O/c1-11(2,10(16)15-14-3)8-6-7(12)4-5-9(8)13/h4-6,14H,1-3H3,(H,15,16) |
| InChIKey | YTOFTKZCLDAKME-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|