C10H13N5O2 — CID 116848655
2-amino-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanehydrazide (PubChem CID 116848655) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-amino-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanehydrazide.
| Compound Name | 2-amino-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanehydrazide |
|---|---|
| PubChem CID | 116848655 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-amino-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanehydrazide |
| SMILES | NNC(=O)C(N)Cc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H13N5O2/c11-6(9(16)15-12)3-5-1-2-7-8(4-5)14-10(17)13-7/h1-2,4,6H,3,11-12H2,(H,15,16)(H2,13,14,17) |
| InChIKey | HYIKJURBZHXEHY-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 129.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|