C30H40F3N3O2 — CID 11685183
[6-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 11685183) has the molecular formula C30H40F3N3O2 and a molecular weight of 531.66 g/mol. Its IUPAC name is [6-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [6-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 11685183 |
| Molecular Formula | C30H40F3N3O2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | [6-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1c(OCCCCN(C)C)ccc(C2CCCC3CN(C(=O)c4ccc(C(F)(F)F)cc4)CCN32)c1C |
| InChI | InChI=1S/C30H40F3N3O2/c1-21-22(2)28(38-19-6-5-16-34(3)4)15-14-26(21)27-9-7-8-25-20-35(17-18-36(25)27)29(37)23-10-12-24(13-11-23)30(31,32)33/h10-15,25,27H,5-9,16-20H2,1-4H3 |
| InChIKey | NJYXOGHHGLMXGV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|