C12H12BrNO2S — CID 116852089
2-[2-(5-bromo-2-methoxyphenyl)-1,3-thiazol-5-yl]ethanol (PubChem CID 116852089) has the molecular formula C12H12BrNO2S and a molecular weight of 314.20 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-methoxyphenyl)-1,3-thiazol-5-yl]ethanol.
| Compound Name | 2-[2-(5-bromo-2-methoxyphenyl)-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 116852089 |
| Molecular Formula | C12H12BrNO2S |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 2-[2-(5-bromo-2-methoxyphenyl)-1,3-thiazol-5-yl]ethanol |
| SMILES | COc1ccc(Br)cc1-c1ncc(CCO)s1 |
| InChI | InChI=1S/C12H12BrNO2S/c1-16-11-3-2-8(13)6-10(11)12-14-7-9(17-12)4-5-15/h2-3,6-7,15H,4-5H2,1H3 |
| InChIKey | KKXXQIYSFMHHNF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |