C14H17NO2S — CID 116852096
2-[2-(4-ethoxy-3-methylphenyl)-1,3-thiazol-5-yl]ethanol (PubChem CID 116852096) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-[2-(4-ethoxy-3-methylphenyl)-1,3-thiazol-5-yl]ethanol.
| Compound Name | 2-[2-(4-ethoxy-3-methylphenyl)-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 116852096 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[2-(4-ethoxy-3-methylphenyl)-1,3-thiazol-5-yl]ethanol |
| SMILES | CCOc1ccc(-c2ncc(CCO)s2)cc1C |
| InChI | InChI=1S/C14H17NO2S/c1-3-17-13-5-4-11(8-10(13)2)14-15-9-12(18-14)6-7-16/h4-5,8-9,16H,3,6-7H2,1-2H3 |
| InChIKey | MRFTZWVDOPMQSL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |