C13H18O3S — CID 116852188
2-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methylpropanoic acid (PubChem CID 116852188) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 116852188 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-(5-ethyl-2-methoxyphenyl)sulfanyl-2-methylpropanoic acid |
| SMILES | CCc1ccc(OC)c(SC(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C13H18O3S/c1-5-9-6-7-10(16-4)11(8-9)17-13(2,3)12(14)15/h6-8H,5H2,1-4H3,(H,14,15) |
| InChIKey | YIDDPEPRGRMJAI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |