2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid

C12H14N2O2S — CID 116852451

IUPAC2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid
SMILESCc1nc2cc(SC(C)C(=O)O)ccc2n1C
InChIInChI=1S/C12H14N2O2S/c1-7(12(15)16)17-9-4-5-11-10(6-9)13-8(2)14(11)3/h4-7H,1-3H3,(H,15,16)
InChIKeyBCAMHKNFZNCSLE-UHFFFAOYSA-N
MW250.32 g/mol
LogP2.45
Rot. Bonds3

About 2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid

2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid (PubChem CID 116852451) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid.

Molecular Properties

Compound Name2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid
PubChem CID116852451
Molecular FormulaC12H14N2O2S
Molecular Weight250.32 g/mol
Exact Mass250.08
IUPAC Name2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid
SMILESCc1nc2cc(SC(C)C(=O)O)ccc2n1C
InChIInChI=1S/C12H14N2O2S/c1-7(12(15)16)17-9-4-5-11-10(6-9)13-8(2)14(11)3/h4-7H,1-3H3,(H,15,16)
InChIKeyBCAMHKNFZNCSLE-UHFFFAOYSA-N
XLogP2.45
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.32
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid?
The IUPAC name of 2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid (CID 116852451) is 2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid.
What is the SMILES notation for 2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid?
The canonical SMILES for 2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid is Cc1nc2cc(SC(C)C(=O)O)ccc2n1C.
What is the InChIKey of 2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid?
The InChIKey is BCAMHKNFZNCSLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2S/c1-7(12(15)16)17-9-4-5-11-10(6-9)13-8(2)14(11)3/h4-7H,1-3H3,(H,15,16).
What are the key properties of 2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid?
2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid has a molecular weight of 250.32 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dimethylbenzimidazol-5-yl)sulfanylpropanoic acid is sourced from PubChem (CID 116852451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).