C14H10BrN3O2 — CID 116854403
6-(5-bromo-2-methoxyphenyl)imidazo[1,2-b]pyridazine-3-carbaldehyde (PubChem CID 116854403) has the molecular formula C14H10BrN3O2 and a molecular weight of 332.16 g/mol. Its IUPAC name is 6-(5-bromo-2-methoxyphenyl)imidazo[1,2-b]pyridazine-3-carbaldehyde.
| Compound Name | 6-(5-bromo-2-methoxyphenyl)imidazo[1,2-b]pyridazine-3-carbaldehyde |
|---|---|
| PubChem CID | 116854403 |
| Molecular Formula | C14H10BrN3O2 |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 6-(5-bromo-2-methoxyphenyl)imidazo[1,2-b]pyridazine-3-carbaldehyde |
| SMILES | COc1ccc(Br)cc1-c1ccc2ncc(C=O)n2n1 |
| InChI | InChI=1S/C14H10BrN3O2/c1-20-13-4-2-9(15)6-11(13)12-3-5-14-16-7-10(8-19)18(14)17-12/h2-8H,1H3 |
| InChIKey | PCIAMCWZXWPMKV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|