About 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde
4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde (PubChem CID 82134718) has the molecular formula C11H8BrNO3
and a molecular weight of 282.09 g/mol. Its IUPAC name is 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde |
| PubChem CID | 82134718 |
| Molecular Formula | C11H8BrNO3 |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde |
| SMILES | COc1ccc(Br)cc1-c1ncoc1C=O |
| InChI | InChI=1S/C11H8BrNO3/c1-15-9-3-2-7(12)4-8(9)11-10(5-14)16-6-13-11/h2-6H,1H3 |
| InChIKey | RCCYRXVOZKOOLS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde?
The IUPAC name of 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde (CID 82134718) is 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde.
What is the SMILES notation for 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde?
The canonical SMILES for 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde is COc1ccc(Br)cc1-c1ncoc1C=O.
What is the InChIKey of 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde?
The InChIKey is RCCYRXVOZKOOLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrNO3/c1-15-9-3-2-7(12)4-8(9)11-10(5-14)16-6-13-11/h2-6H,1H3.
What are the key properties of 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde?
4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde has a molecular weight of 282.09 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde is sourced from PubChem (CID 82134718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).