C11H8BrNO3 — CID 82134718
4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde (PubChem CID 82134718) has the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. Its IUPAC name is 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde.
| Compound Name | 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 82134718 |
| Molecular Formula | C11H8BrNO3 |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 4-(5-bromo-2-methoxyphenyl)-1,3-oxazole-5-carbaldehyde |
| SMILES | COc1ccc(Br)cc1-c1ncoc1C=O |
| InChI | InChI=1S/C11H8BrNO3/c1-15-9-3-2-7(12)4-8(9)11-10(5-14)16-6-13-11/h2-6H,1H3 |
| InChIKey | RCCYRXVOZKOOLS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|