C11H11BrN2OS — CID 62082556
4-(5-bromo-2-methoxyphenyl)-2-methyl-1,3-thiazol-5-amine (PubChem CID 62082556) has the molecular formula C11H11BrN2OS and a molecular weight of 299.19 g/mol. Its IUPAC name is 4-(5-bromo-2-methoxyphenyl)-2-methyl-1,3-thiazol-5-amine.
| Compound Name | 4-(5-bromo-2-methoxyphenyl)-2-methyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 62082556 |
| Molecular Formula | C11H11BrN2OS |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 4-(5-bromo-2-methoxyphenyl)-2-methyl-1,3-thiazol-5-amine |
| SMILES | COc1ccc(Br)cc1-c1nc(C)sc1N |
| InChI | InChI=1S/C11H11BrN2OS/c1-6-14-10(11(13)16-6)8-5-7(12)3-4-9(8)15-2/h3-5H,13H2,1-2H3 |
| InChIKey | FQDUOMDFIORQRZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |