C11H11BrN2O2 — CID 82134756
3-(5-bromo-2-methoxyphenyl)-4-methyl-1,2-oxazol-5-amine (PubChem CID 82134756) has the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxyphenyl)-4-methyl-1,2-oxazol-5-amine.
| Compound Name | 3-(5-bromo-2-methoxyphenyl)-4-methyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 82134756 |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 3-(5-bromo-2-methoxyphenyl)-4-methyl-1,2-oxazol-5-amine |
| SMILES | COc1ccc(Br)cc1-c1noc(N)c1C |
| InChI | InChI=1S/C11H11BrN2O2/c1-6-10(14-16-11(6)13)8-5-7(12)3-4-9(8)15-2/h3-5H,13H2,1-2H3 |
| InChIKey | OWILPVQESBWEMN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |