C12H14N2O2 — CID 62505613
3-(2-methoxy-5-methylphenyl)-4-methyl-1,2-oxazol-5-amine (PubChem CID 62505613) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-(2-methoxy-5-methylphenyl)-4-methyl-1,2-oxazol-5-amine.
| Compound Name | 3-(2-methoxy-5-methylphenyl)-4-methyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 62505613 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-(2-methoxy-5-methylphenyl)-4-methyl-1,2-oxazol-5-amine |
| SMILES | COc1ccc(C)cc1-c1noc(N)c1C |
| InChI | InChI=1S/C12H14N2O2/c1-7-4-5-10(15-3)9(6-7)11-8(2)12(13)16-14-11/h4-6H,13H2,1-3H3 |
| InChIKey | KBKYUYOZMDUJSR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |