C14H14BrN3O2 — CID 136995593
2-(5-bromo-2-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-3-carbaldehyde (PubChem CID 136995593) has the molecular formula C14H14BrN3O2 and a molecular weight of 336.19 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-3-carbaldehyde.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-3-carbaldehyde |
|---|---|
| PubChem CID | 136995593 |
| Molecular Formula | C14H14BrN3O2 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-3-carbaldehyde |
| SMILES | COc1ccc(Br)cc1-c1nc2n(c1C=O)CCCN2 |
| InChI | InChI=1S/C14H14BrN3O2/c1-20-12-4-3-9(15)7-10(12)13-11(8-19)18-6-2-5-16-14(18)17-13/h3-4,7-8H,2,5-6H2,1H3,(H,16,17) |
| InChIKey | YGPUUZJDZRWQLG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|