C13H16N2O4 — CID 116856099
5-(3,4-dimethoxyphenyl)-5-methylpiperazine-2,3-dione (PubChem CID 116856099) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-5-methylpiperazine-2,3-dione.
| Compound Name | 5-(3,4-dimethoxyphenyl)-5-methylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 116856099 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-5-methylpiperazine-2,3-dione |
| SMILES | COc1ccc(C2(C)CNC(=O)C(=O)N2)cc1OC |
| InChI | InChI=1S/C13H16N2O4/c1-13(7-14-11(16)12(17)15-13)8-4-5-9(18-2)10(6-8)19-3/h4-6H,7H2,1-3H3,(H,14,16)(H,15,17) |
| InChIKey | KVKQRTCVYCRWNX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|