C12H9ClN2O2 — CID 116858887
5-(3-chloro-4-ethoxyphenyl)-1,2-oxazole-3-carbonitrile (PubChem CID 116858887) has the molecular formula C12H9ClN2O2 and a molecular weight of 248.67 g/mol. Its IUPAC name is 5-(3-chloro-4-ethoxyphenyl)-1,2-oxazole-3-carbonitrile.
| Compound Name | 5-(3-chloro-4-ethoxyphenyl)-1,2-oxazole-3-carbonitrile |
|---|---|
| PubChem CID | 116858887 |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-(3-chloro-4-ethoxyphenyl)-1,2-oxazole-3-carbonitrile |
| SMILES | CCOc1ccc(-c2cc(C#N)no2)cc1Cl |
| InChI | InChI=1S/C12H9ClN2O2/c1-2-16-11-4-3-8(5-10(11)13)12-6-9(7-14)15-17-12/h3-6H,2H2,1H3 |
| InChIKey | KJQVONMJHKKOML-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |