C10H5FN2O — CID 116858951
5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile (PubChem CID 116858951) has the molecular formula C10H5FN2O and a molecular weight of 188.16 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile.
| Compound Name | 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile |
|---|---|
| PubChem CID | 116858951 |
| Molecular Formula | C10H5FN2O |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile |
| SMILES | N#Cc1cc(-c2cccc(F)c2)on1 |
| InChI | InChI=1S/C10H5FN2O/c11-8-3-1-2-7(4-8)10-5-9(6-12)13-14-10/h1-5H |
| InChIKey | GSYGPMKNLDLAQT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |