About 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile
5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile (PubChem CID 116858951) has the molecular formula C10H5FN2O
and a molecular weight of 188.16 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile |
| PubChem CID | 116858951 |
| Molecular Formula | C10H5FN2O |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile |
| SMILES | N#Cc1cc(-c2cccc(F)c2)on1 |
| InChI | InChI=1S/C10H5FN2O/c11-8-3-1-2-7(4-8)10-5-9(6-12)13-14-10/h1-5H |
| InChIKey | GSYGPMKNLDLAQT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile?
The IUPAC name of 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile (CID 116858951) is 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile.
What is the SMILES notation for 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile?
The canonical SMILES for 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile is N#Cc1cc(-c2cccc(F)c2)on1.
What is the InChIKey of 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile?
The InChIKey is GSYGPMKNLDLAQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5FN2O/c11-8-3-1-2-7(4-8)10-5-9(6-12)13-14-10/h1-5H.
What are the key properties of 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile?
5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile has a molecular weight of 188.16 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluorophenyl)-1,2-oxazole-3-carbonitrile is sourced from PubChem (CID 116858951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).