C13H22N2O3 — CID 116861111
tert-butyl N-[1-hydroxy-3-(1H-pyrrol-3-yl)propan-2-yl]-N-methylcarbamate (PubChem CID 116861111) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl N-[1-hydroxy-3-(1H-pyrrol-3-yl)propan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-hydroxy-3-(1H-pyrrol-3-yl)propan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 116861111 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | tert-butyl N-[1-hydroxy-3-(1H-pyrrol-3-yl)propan-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C(CO)Cc1cc[nH]c1 |
| InChI | InChI=1S/C13H22N2O3/c1-13(2,3)18-12(17)15(4)11(9-16)7-10-5-6-14-8-10/h5-6,8,11,14,16H,7,9H2,1-4H3 |
| InChIKey | WUCRRGCDEAJSJI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |