C14H21NO — CID 116861384
4-amino-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-1-ol (PubChem CID 116861384) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-amino-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-1-ol.
| Compound Name | 4-amino-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 116861384 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 4-amino-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-1-ol |
| SMILES | NC(CCCO)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C14H21NO/c15-14(6-3-9-16)13-8-7-11-4-1-2-5-12(11)10-13/h7-8,10,14,16H,1-6,9,15H2 |
| InChIKey | UNPJIOZLPABUFW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |