C14H19N — CID 104987476
1-(2,3-dihydro-1H-inden-5-yl)pent-4-en-1-amine (PubChem CID 104987476) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)pent-4-en-1-amine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 104987476 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)pent-4-en-1-amine |
| SMILES | C=CCCC(N)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H19N/c1-2-3-7-14(15)13-9-8-11-5-4-6-12(11)10-13/h2,8-10,14H,1,3-7,15H2 |
| InChIKey | XRFYGPWQDGGZBB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|