C17H24O2 — CID 116865934
(E)-5-(4-tert-butyl-2,6-dimethylphenyl)pent-2-enoic acid (PubChem CID 116865934) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (E)-5-(4-tert-butyl-2,6-dimethylphenyl)pent-2-enoic acid.
| Compound Name | (E)-5-(4-tert-butyl-2,6-dimethylphenyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 116865934 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (E)-5-(4-tert-butyl-2,6-dimethylphenyl)pent-2-enoic acid |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1CC/C=C/C(=O)O |
| InChI | InChI=1S/C17H24O2/c1-12-10-14(17(3,4)5)11-13(2)15(12)8-6-7-9-16(18)19/h7,9-11H,6,8H2,1-5H3,(H,18,19)/b9-7+ |
| InChIKey | FHXDZOZOWIOGBF-VQHVLOKHSA-N |
| XLogP | 4.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|