C11H7ClN2OS — CID 116866925
4-(3-chloro-4-methoxyphenyl)-1,3-thiazole-5-carbonitrile (PubChem CID 116866925) has the molecular formula C11H7ClN2OS and a molecular weight of 250.71 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxyphenyl)-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-(3-chloro-4-methoxyphenyl)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 116866925 |
| Molecular Formula | C11H7ClN2OS |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 4-(3-chloro-4-methoxyphenyl)-1,3-thiazole-5-carbonitrile |
| SMILES | COc1ccc(-c2ncsc2C#N)cc1Cl |
| InChI | InChI=1S/C11H7ClN2OS/c1-15-9-3-2-7(4-8(9)12)11-10(5-13)16-6-14-11/h2-4,6H,1H3 |
| InChIKey | VUVSOWLNEDCEJY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |