C13H15NO2S — CID 116867830
2-[4-(3-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]ethanol (PubChem CID 116867830) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-[4-(3-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]ethanol.
| Compound Name | 2-[4-(3-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 116867830 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-[4-(3-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]ethanol |
| SMILES | COc1cccc(-c2nc(CCO)sc2C)c1 |
| InChI | InChI=1S/C13H15NO2S/c1-9-13(14-12(17-9)6-7-15)10-4-3-5-11(8-10)16-2/h3-5,8,15H,6-7H2,1-2H3 |
| InChIKey | LDXNJPIECYBUJB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |